About N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide
N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide (PubChem CID 140855869) has the molecular formula C20H22Cl2N6O
and a molecular weight of 433.34 g/mol. Its IUPAC name is N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide |
| PubChem CID | 140855869 |
| Molecular Formula | C20H22Cl2N6O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCn1cc(-c2nnc(NC3CCCC3)c3cc(Cl)c(Cl)cc23)cn1 |
| InChI | InChI=1S/C20H22Cl2N6O/c1-12(29)23-6-7-28-11-13(10-24-28)19-15-8-17(21)18(22)9-16(15)20(27-26-19)25-14-4-2-3-5-14/h8-11,14H,2-7H2,1H3,(H,23,29)(H,25,27) |
| InChIKey | ZJOWEYNTUPHNRB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide?
The IUPAC name of N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide (CID 140855869) is N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide.
What is the SMILES notation for N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide?
The canonical SMILES for N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide is CC(=O)NCCn1cc(-c2nnc(NC3CCCC3)c3cc(Cl)c(Cl)cc23)cn1.
What is the InChIKey of N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide?
The InChIKey is ZJOWEYNTUPHNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N6O/c1-12(29)23-6-7-28-11-13(10-24-28)19-15-8-17(21)18(22)9-16(15)20(27-26-19)25-14-4-2-3-5-14/h8-11,14H,2-7H2,1H3,(H,23,29)(H,25,27).
What are the key properties of N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide?
N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide has a molecular weight of 433.34 g/mol, XLogP of 4.29, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-[6,7-dichloro-4-(cyclopentylamino)phthalazin-1-yl]pyrazol-1-yl]ethyl]acetamide is sourced from PubChem (CID 140855869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).