About N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide
N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide (PubChem CID 140856271) has the molecular formula C7H13F2N5
and a molecular weight of 205.21 g/mol. Its IUPAC name is N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide |
| PubChem CID | 140856271 |
| Molecular Formula | C7H13F2N5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide |
| SMILES | [H]/N=C(N)/N=C(\N)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H13F2N5/c8-7(9)1-3-14(4-2-7)6(12)13-5(10)11/h1-4H2,(H5,10,11,12,13) |
| InChIKey | FROXEWYWMWEUOF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide?
The IUPAC name of N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide (CID 140856271) is N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide.
What is the SMILES notation for N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide?
The canonical SMILES for N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide is [H]/N=C(N)/N=C(\N)N1CCC(F)(F)CC1.
What is the InChIKey of N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide?
The InChIKey is FROXEWYWMWEUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N5/c8-7(9)1-3-14(4-2-7)6(12)13-5(10)11/h1-4H2,(H5,10,11,12,13).
What are the key properties of N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide?
N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide has a molecular weight of 205.21 g/mol, XLogP of -0.07, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-carbamimidoyl-4,4-difluoropiperidine-1-carboximidamide is sourced from PubChem (CID 140856271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).