C29H25N3O2SSe — CID 140856942
1,3-dimethyl-5-[[5-(2-methyl-N-(2-methylnaphthalen-1-yl)anilino)selenophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 140856942) has the molecular formula C29H25N3O2SSe and a molecular weight of 558.57 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[5-(2-methyl-N-(2-methylnaphthalen-1-yl)anilino)selenophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dimethyl-5-[[5-(2-methyl-N-(2-methylnaphthalen-1-yl)anilino)selenophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 140856942 |
| Molecular Formula | C29H25N3O2SSe |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 1,3-dimethyl-5-[[5-(2-methyl-N-(2-methylnaphthalen-1-yl)anilino)selenophen-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccccc1N(c1ccc(C=C2C(=O)N(C)C(=S)N(C)C2=O)[se]1)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C29H25N3O2SSe/c1-18-9-5-8-12-24(18)32(26-19(2)13-14-20-10-6-7-11-22(20)26)25-16-15-21(36-25)17-23-27(33)30(3)29(35)31(4)28(23)34/h5-17H,1-4H3 |
| InChIKey | DRWPXUAPKFFKOO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|