C28H60O4Si3 — CID 140857069
[(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140857069) has the molecular formula C28H60O4Si3 and a molecular weight of 545.04 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140857069 |
| Molecular Formula | C28H60O4Si3 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | [(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H](C)[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H60O4Si3/c1-18-21(2)25-23(32-35(16,17)28(9,10)11)19-22(31-34(14,15)27(6,7)8)24(30-25)20-29-33(12,13)26(3,4)5/h18,21-25H,1,19-20H2,2-17H3/t21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | DZWALKJDQBIQLZ-KKGFQHLNSA-N |
| XLogP | 8.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|