C30H37F3N2O5 — CID 140857494
(2R,3S,4R,5R)-3-tert-butyl-1-[(1S,3S)-3-methoxycyclohexanecarbonyl]-4-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]oxy]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857494) has the molecular formula C30H37F3N2O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-tert-butyl-1-[(1S,3S)-3-methoxycyclohexanecarbonyl]-4-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]oxy]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5R)-3-tert-butyl-1-[(1S,3S)-3-methoxycyclohexanecarbonyl]-4-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]oxy]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857494 |
| Molecular Formula | C30H37F3N2O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | (2R,3S,4R,5R)-3-tert-butyl-1-[(1S,3S)-3-methoxycyclohexanecarbonyl]-4-[[6-methyl-4-(trifluoromethyl)-2-pyridinyl]oxy]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | CO[C@H]1CCC[C@H](C(=O)N2[C@H](c3ccccc3)[C@H](Oc3cc(C(F)(F)F)cc(C)n3)[C@@H](C(C)(C)C)[C@@H]2C(=O)O)C1 |
| InChI | InChI=1S/C30H37F3N2O5/c1-17-14-20(30(31,32)33)16-22(34-17)40-26-23(29(2,3)4)25(28(37)38)35(24(26)18-10-7-6-8-11-18)27(36)19-12-9-13-21(15-19)39-5/h6-8,10-11,14,16,19,21,23-26H,9,12-13,15H2,1-5H3,(H,37,38)/t19-,21-,23-,24+,25+,26+/m0/s1 |
| InChIKey | AWBSHWCUWYHTQA-JAEWMJQYSA-N |
| XLogP | 6.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |