C38H54N2O4 — CID 140858249
(2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140858249) has the molecular formula C38H54N2O4 and a molecular weight of 602.86 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140858249 |
| Molecular Formula | C38H54N2O4 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1cc2c(cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C3CCCCC3)[C@H]1c1ccccc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C38H54N2O4/c1-36(2,3)30-31(39-23-26-21-27-28(22-29(26)44-8)38(6,7)20-19-37(27,4)5)32(24-15-11-9-12-16-24)40(33(30)35(42)43)34(41)25-17-13-10-14-18-25/h9,11-12,15-16,21-22,25,30-33,39H,10,13-14,17-20,23H2,1-8H3,(H,42,43)/t30-,31-,32-,33-/m0/s1 |
| InChIKey | ZVPOOMSDWVYMPW-YRCZKMHPSA-N |
| XLogP | 7.78 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |