C35H48N2O5 — CID 140858456
(2S,3S,4S,5S)-3-tert-butyl-4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-1-[(2S)-oxane-2-carbonyl]-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 140858456) has the molecular formula C35H48N2O5 and a molecular weight of 576.78 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-1-[(2S)-oxane-2-carbonyl]-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-1-[(2S)-oxane-2-carbonyl]-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140858456 |
| Molecular Formula | C35H48N2O5 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methylamino]-1-[(2S)-oxane-2-carbonyl]-5-(2-propan-2-ylphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)c1ccccc1[C@H]1[C@@H](NCc2cccc3c2OC(C)(C)C3)[C@H](C(C)(C)C)[C@@H](C(=O)O)N1C(=O)[C@@H]1CCCCO1 |
| InChI | InChI=1S/C35H48N2O5/c1-21(2)24-15-8-9-16-25(24)29-28(36-20-23-14-12-13-22-19-35(6,7)42-31(22)23)27(34(3,4)5)30(33(39)40)37(29)32(38)26-17-10-11-18-41-26/h8-9,12-16,21,26-30,36H,10-11,17-20H2,1-7H3,(H,39,40)/t26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | CTKWASSLHRPSJY-IIZANFQQSA-N |
| XLogP | 6.25 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |