C32H39F3N2O6 — CID 140858634
(2S,3S,4S,5S)-3-tert-butyl-5-(2,3-dihydro-1-benzofuran-7-yl)-4-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 140858634) has the molecular formula C32H39F3N2O6 and a molecular weight of 604.67 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-5-(2,3-dihydro-1-benzofuran-7-yl)-4-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-5-(2,3-dihydro-1-benzofuran-7-yl)-4-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140858634 |
| Molecular Formula | C32H39F3N2O6 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-5-(2,3-dihydro-1-benzofuran-7-yl)-4-[[2-methoxy-4-(trifluoromethyl)phenyl]methylamino]-1-[(2S)-oxane-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1cc(C(F)(F)F)ccc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)[C@@H]2CCCCO2)[C@H]1c1cccc2c1OCC2 |
| InChI | InChI=1S/C32H39F3N2O6/c1-31(2,3)24-25(36-17-19-11-12-20(32(33,34)35)16-23(19)41-4)26(21-9-7-8-18-13-15-43-28(18)21)37(27(24)30(39)40)29(38)22-10-5-6-14-42-22/h7-9,11-12,16,22,24-27,36H,5-6,10,13-15,17H2,1-4H3,(H,39,40)/t22-,24-,25-,26-,27-/m0/s1 |
| InChIKey | RSGHMRHWPYCZRP-KGRAHGMMSA-N |
| XLogP | 5.38 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |