C32H45F2N3O4Si — CID 140859371
(2S,3S,4S,5S)-3-tert-butyl-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-4-[(2-methoxy-5-trimethylsilyl-3-pyridinyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140859371) has the molecular formula C32H45F2N3O4Si and a molecular weight of 601.81 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-4-[(2-methoxy-5-trimethylsilyl-3-pyridinyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-4-[(2-methoxy-5-trimethylsilyl-3-pyridinyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140859371 |
| Molecular Formula | C32H45F2N3O4Si |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-4-[(2-methoxy-5-trimethylsilyl-3-pyridinyl)methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ncc([Si](C)(C)C)cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)[C@@H]2CCCC(F)(F)C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H45F2N3O4Si/c1-31(2,3)24-25(35-18-22-16-23(42(5,6)7)19-36-28(22)41-4)26(20-12-9-8-10-13-20)37(27(24)30(39)40)29(38)21-14-11-15-32(33,34)17-21/h8-10,12-13,16,19,21,24-27,35H,11,14-15,17-18H2,1-7H3,(H,39,40)/t21-,24+,25+,26+,27+/m1/s1 |
| InChIKey | JISMNIDBHOXSQU-FFXRMZKPSA-N |
| XLogP | 5.62 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|