About tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate
tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate (PubChem CID 140859891) has the molecular formula C16H22F2N2O4
and a molecular weight of 344.36 g/mol. Its IUPAC name is tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate |
| PubChem CID | 140859891 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)OC(C)(C)Cc1c(F)ccc(N)c1F |
| InChI | InChI=1S/C16H22F2N2O4/c1-15(2,3)23-13(21)20-14(22)24-16(4,5)8-9-10(17)6-7-11(19)12(9)18/h6-7H,8,19H2,1-5H3,(H,20,21,22) |
| InChIKey | MOHAIBUPUZMJQV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate?
The IUPAC name of tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate (CID 140859891) is tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate.
What is the SMILES notation for tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate?
The canonical SMILES for tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate is CC(C)(C)OC(=O)NC(=O)OC(C)(C)Cc1c(F)ccc(N)c1F.
What is the InChIKey of tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate?
The InChIKey is MOHAIBUPUZMJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O4/c1-15(2,3)23-13(21)20-14(22)24-16(4,5)8-9-10(17)6-7-11(19)12(9)18/h6-7H,8,19H2,1-5H3,(H,20,21,22).
What are the key properties of tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate?
tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate has a molecular weight of 344.36 g/mol, XLogP of 3.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(3-amino-2,6-difluorophenyl)-2-methylpropan-2-yl]oxycarbonylcarbamate is sourced from PubChem (CID 140859891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).