About 4-methylsulfanylphenol
4-methylsulfanylphenol (PubChem CID 14086) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 4-methylsulfanylphenol.
Molecular Properties
| Compound Name | 4-methylsulfanylphenol |
| PubChem CID | 14086 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 4-methylsulfanylphenol |
| SMILES | CSc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8OS/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| InChIKey | QASBCTGZKABPKX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylsulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanylphenol?
The IUPAC name of 4-methylsulfanylphenol (CID 14086) is 4-methylsulfanylphenol.
What is the SMILES notation for 4-methylsulfanylphenol?
The canonical SMILES for 4-methylsulfanylphenol is CSc1ccc(O)cc1.
What is the InChIKey of 4-methylsulfanylphenol?
The InChIKey is QASBCTGZKABPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3.
What are the key properties of 4-methylsulfanylphenol?
4-methylsulfanylphenol has a molecular weight of 140.21 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanylphenol is sourced from PubChem (CID 14086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).