C38H54N2Si2 — CID 140861263
2-[3,8-dimethyl-10-[2-tri(propan-2-yl)silylethynyl]indolo[7,6-g]indol-5-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 140861263) has the molecular formula C38H54N2Si2 and a molecular weight of 595.04 g/mol. Its IUPAC name is 2-[3,8-dimethyl-10-[2-tri(propan-2-yl)silylethynyl]indolo[7,6-g]indol-5-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[3,8-dimethyl-10-[2-tri(propan-2-yl)silylethynyl]indolo[7,6-g]indol-5-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140861263 |
| Molecular Formula | C38H54N2Si2 |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | 2-[3,8-dimethyl-10-[2-tri(propan-2-yl)silylethynyl]indolo[7,6-g]indol-5-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cc2c(cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c3ccn(C)c32)c2c1ccn2C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H54N2Si2/c1-25(2)41(26(3)4,27(5)6)21-17-31-23-35-36(37-33(31)15-19-39(37)13)24-32(34-16-20-40(14)38(34)35)18-22-42(28(7)8,29(9)10)30(11)12/h15-16,19-20,23-30H,1-14H3 |
| InChIKey | KQYPSSZRILAZPZ-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|