About [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate
[2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate (PubChem CID 14086155) has the molecular formula C30H37NO3
and a molecular weight of 459.63 g/mol. Its IUPAC name is [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate |
| PubChem CID | 14086155 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate |
| SMILES | CC(C)(CCCCOc1ccc(CCCCc2ccccc2)cc1)COC(=O)c1cccnc1 |
| InChI | InChI=1S/C30H37NO3/c1-30(2,24-34-29(32)27-15-10-21-31-23-27)20-8-9-22-33-28-18-16-26(17-19-28)14-7-6-13-25-11-4-3-5-12-25/h3-5,10-12,15-19,21,23H,6-9,13-14,20,22,24H2,1-2H3 |
| InChIKey | WITHPQOUBSFJHY-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate?
The IUPAC name of [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate (CID 14086155) is [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate.
What is the SMILES notation for [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate?
The canonical SMILES for [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate is CC(C)(CCCCOc1ccc(CCCCc2ccccc2)cc1)COC(=O)c1cccnc1.
What is the InChIKey of [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate?
The InChIKey is WITHPQOUBSFJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO3/c1-30(2,24-34-29(32)27-15-10-21-31-23-27)20-8-9-22-33-28-18-16-26(17-19-28)14-7-6-13-25-11-4-3-5-12-25/h3-5,10-12,15-19,21,23H,6-9,13-14,20,22,24H2,1-2H3.
What are the key properties of [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate?
[2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate has a molecular weight of 459.63 g/mol, XLogP of 7.08, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexyl] pyridine-3-carboxylate is sourced from PubChem (CID 14086155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).