C29H34BNO4 — CID 140861650
(2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-phenylpropanamide (PubChem CID 140861650) has the molecular formula C29H34BNO4 and a molecular weight of 471.41 g/mol. Its IUPAC name is (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-phenylpropanamide.
| Compound Name | (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 140861650 |
| Molecular Formula | C29H34BNO4 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-phenylpropanamide |
| SMILES | C[C@@H](C(=O)N[C@@H](Cc1coc2ccccc12)B1O[C@@H]2CC3C[C@@H](C3(C)C)[C@]2(C)O1)c1ccccc1 |
| InChI | InChI=1S/C29H34BNO4/c1-18(19-10-6-5-7-11-19)27(32)31-26(14-20-17-33-23-13-9-8-12-22(20)23)30-34-25-16-21-15-24(28(21,2)3)29(25,4)35-30/h5-13,17-18,21,24-26H,14-16H2,1-4H3,(H,31,32)/t18-,21?,24+,25-,26+,29+/m1/s1 |
| InChIKey | QYIDQYDGXCBAAL-GXJNVPBESA-N |
| XLogP | 5.53 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|