C29H34BNO5 — CID 140861698
(2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxy-2-phenylacetamide (PubChem CID 140861698) has the molecular formula C29H34BNO5 and a molecular weight of 487.41 g/mol. Its IUPAC name is (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 140861698 |
| Molecular Formula | C29H34BNO5 |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2R)-N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)N[C@@H](Cc1coc2ccccc12)B1O[C@@H]2CC3C[C@@H](C3(C)C)[C@]2(C)O1)c1ccccc1 |
| InChI | InChI=1S/C29H34BNO5/c1-28(2)20-15-23(28)29(3)24(16-20)35-30(36-29)25(14-19-17-34-22-13-9-8-12-21(19)22)31-27(32)26(33-4)18-10-6-5-7-11-18/h5-13,17,20,23-26H,14-16H2,1-4H3,(H,31,32)/t20?,23-,24+,25-,26+,29-/m0/s1 |
| InChIKey | VYRWVBKLAFFIDV-JTMIWMKWSA-N |
| XLogP | 5.12 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|