C20H22BF3N2O4 — CID 140861748
[(1R)-2-(2,4-dimethylphenyl)-1-[[2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]acetyl]amino]ethyl]boronic acid (PubChem CID 140861748) has the molecular formula C20H22BF3N2O4 and a molecular weight of 422.21 g/mol. Its IUPAC name is [(1R)-2-(2,4-dimethylphenyl)-1-[[2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]acetyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(2,4-dimethylphenyl)-1-[[2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140861748 |
| Molecular Formula | C20H22BF3N2O4 |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [(1R)-2-(2,4-dimethylphenyl)-1-[[2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]acetyl]amino]ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)Cc2ccc(NC(=O)C(F)(F)F)cc2)B(O)O)c(C)c1 |
| InChI | InChI=1S/C20H22BF3N2O4/c1-12-3-6-15(13(2)9-12)11-17(21(29)30)26-18(27)10-14-4-7-16(8-5-14)25-19(28)20(22,23)24/h3-9,17,29-30H,10-11H2,1-2H3,(H,25,28)(H,26,27)/t17-/m0/s1 |
| InChIKey | KJWILCFZWSKQOJ-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|