C29H32BF2NO5 — CID 140861789
N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-difluoro-2-(4-methoxyphenyl)acetamide (PubChem CID 140861789) has the molecular formula C29H32BF2NO5 and a molecular weight of 523.39 g/mol. Its IUPAC name is N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-difluoro-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-difluoro-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 140861789 |
| Molecular Formula | C29H32BF2NO5 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-difluoro-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(F)(F)C(=O)N[C@@H](Cc2coc3ccccc23)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C29H32BF2NO5/c1-27(2)19-14-23(27)28(3)24(15-19)37-30(38-28)25(13-17-16-36-22-8-6-5-7-21(17)22)33-26(34)29(31,32)18-9-11-20(35-4)12-10-18/h5-12,16,19,23-25H,13-15H2,1-4H3,(H,33,34)/t19-,23-,24+,25-,28-/m0/s1 |
| InChIKey | FDQCNSPIVFINJQ-HKSODBGBSA-N |
| XLogP | 5.53 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|