C25H32N2O6 — CID 140861929
ethyl 2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate (PubChem CID 140861929) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl 2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 140861929 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | ethyl 2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-c2ccccc2)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C25H32N2O6/c1-8-31-20(28)16-18-14-15-19(17-12-10-9-11-13-17)21(26-18)27(22(29)32-24(2,3)4)23(30)33-25(5,6)7/h9-15H,8,16H2,1-7H3 |
| InChIKey | FWUVXRVDENXNRZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|