C25H31N3O7 — CID 140861950
ethyl (2Z)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]-2-hydroxyiminoacetate (PubChem CID 140861950) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is ethyl (2Z)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]-2-hydroxyiminoacetate.
| Compound Name | ethyl (2Z)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 140861950 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | ethyl (2Z)-2-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenyl-2-pyridinyl]-2-hydroxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\O)c1ccc(-c2ccccc2)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C25H31N3O7/c1-8-33-21(29)19(27-32)18-15-14-17(16-12-10-9-11-13-16)20(26-18)28(22(30)34-24(2,3)4)23(31)35-25(5,6)7/h9-15,32H,8H2,1-7H3/b27-19- |
| InChIKey | UZHZWRRIGMWOLW-DIBXZPPDSA-N |
| XLogP | 5.17 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|