C18H36GdN4O10 — CID 140862392
2-[4,10-bis(carboxymethyl)-7-[(3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium;hydrate (PubChem CID 140862392) has the molecular formula C18H36GdN4O10 and a molecular weight of 625.75 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[(3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium;hydrate.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[(3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium;hydrate |
|---|---|
| PubChem CID | 140862392 |
| Molecular Formula | C18H36GdN4O10 |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[(3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium;hydrate |
| SMILES | O.O=C(O)CN1CCN(CC(=O)O)CCN(C(CO)[C@@H](O)CO)CCN(CC(=O)O)CC1.[Gd] |
| InChI | InChI=1S/C18H34N4O9.Gd.H2O/c23-12-14(15(25)13-24)22-7-5-20(10-17(28)29)3-1-19(9-16(26)27)2-4-21(6-8-22)11-18(30)31;;/h14-15,23-25H,1-13H2,(H,26,27)(H,28,29)(H,30,31);;1H2/t14?,15-;;/m0../s1 |
| InChIKey | IBEUYXZRRFGTQR-VGYAGVDUSA-N |
| XLogP | -4.65 |
| TPSA | 217.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |