C18H17FN4O2 — CID 140862945
1-cyclohexyl-4-(6-fluoro-3-pyridinyl)pyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 140862945) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-cyclohexyl-4-(6-fluoro-3-pyridinyl)pyrazolo[5,4-b]pyridine-6-carboxylic acid.
| Compound Name | 1-cyclohexyl-4-(6-fluoro-3-pyridinyl)pyrazolo[5,4-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 140862945 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-cyclohexyl-4-(6-fluoro-3-pyridinyl)pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)nc2)c2cnn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C18H17FN4O2/c19-16-7-6-11(9-20-16)13-8-15(18(24)25)22-17-14(13)10-21-23(17)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H,24,25) |
| InChIKey | CFUKDMUINXQXFP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|