C14H12BN3O — CID 140863842
CID 140863842 (PubChem CID 140863842) has the molecular formula C14H12BN3O and a molecular weight of 249.08 g/mol.
| Compound Name | CID 140863842 |
|---|---|
| PubChem CID | 140863842 |
| Molecular Formula | C14H12BN3O |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(N)c(-c2ccc3c(c2)CCNC3=O)c1 |
| InChI | InChI=1S/C14H12BN3O/c15-10-6-12(13(16)18-7-10)8-1-2-11-9(5-8)3-4-17-14(11)19/h1-2,5-7H,3-4H2,(H2,16,18)(H,17,19) |
| InChIKey | KDHUMGVEMWEYAY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|