C23H29Cl2N5O2 — CID 14086455
4-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione;hydrochloride (PubChem CID 14086455) has the molecular formula C23H29Cl2N5O2 and a molecular weight of 478.42 g/mol. Its IUPAC name is 4-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione;hydrochloride.
| Compound Name | 4-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione;hydrochloride |
|---|---|
| PubChem CID | 14086455 |
| Molecular Formula | C23H29Cl2N5O2 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[4-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione;hydrochloride |
| SMILES | Cl.O=C1C2C3C=CC(C4CC34)C2C(=O)N1CCCCN1CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C23H28ClN5O2.ClH/c24-18-5-6-19(26-25-18)28-11-9-27(10-12-28)7-1-2-8-29-22(30)20-14-3-4-15(17-13-16(14)17)21(20)23(29)31;/h3-6,14-17,20-21H,1-2,7-13H2;1H |
| InChIKey | SIKHXSANFCPZTN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|