C24H30ClN5O2 — CID 14086495
4-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione (PubChem CID 14086495) has the molecular formula C24H30ClN5O2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 4-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione.
| Compound Name | 4-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
|---|---|
| PubChem CID | 14086495 |
| Molecular Formula | C24H30ClN5O2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C4CCC34)C2C(=O)N1CCCCN1CCN(c2cncc(Cl)n2)CC1 |
| InChI | InChI=1S/C24H30ClN5O2/c25-19-13-26-14-20(27-19)29-11-9-28(10-12-29)7-1-2-8-30-23(31)21-17-5-6-18(22(21)24(30)32)16-4-3-15(16)17/h5-6,13-18,21-22H,1-4,7-12H2 |
| InChIKey | RSTBAYLBZBFSKD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|