3-(3-hydroxydec-2-enoyloxy)octanoic acid

C18H32O5 — CID 140865721

IUPAC3-(3-hydroxydec-2-enoyloxy)octanoic acid
SMILESCCCCCCCC(O)=CC(=O)OC(CCCCC)CC(=O)O
InChIInChI=1S/C18H32O5/c1-3-5-7-8-10-11-15(19)13-18(22)23-16(14-17(20)21)12-9-6-4-2/h13,16,19H,3-12,14H2,1-2H3,(H,20,21)
InChIKeyJHUXTARWINDQNP-UHFFFAOYSA-N
MW328.45 g/mol
LogP4.76
Rot. Bonds14

About 3-(3-hydroxydec-2-enoyloxy)octanoic acid

3-(3-hydroxydec-2-enoyloxy)octanoic acid (PubChem CID 140865721) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is 3-(3-hydroxydec-2-enoyloxy)octanoic acid.

Molecular Properties

Compound Name3-(3-hydroxydec-2-enoyloxy)octanoic acid
PubChem CID140865721
Molecular FormulaC18H32O5
Molecular Weight328.45 g/mol
Exact Mass328.22
IUPAC Name3-(3-hydroxydec-2-enoyloxy)octanoic acid
SMILESCCCCCCCC(O)=CC(=O)OC(CCCCC)CC(=O)O
InChIInChI=1S/C18H32O5/c1-3-5-7-8-10-11-15(19)13-18(22)23-16(14-17(20)21)12-9-6-4-2/h13,16,19H,3-12,14H2,1-2H3,(H,20,21)
InChIKeyJHUXTARWINDQNP-UHFFFAOYSA-N
XLogP4.76
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds14
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.45
LogP ≤ 54.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(3-hydroxydec-2-enoyloxy)octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(3-hydroxydodec-2-enoyloxy)octanoic acid
CID 140865768
3-(3-hydroxydec-2-enoyloxy)nonanoic acid
CID 140865772
3-prop-2-enoyloxypentadecanoic acid
CID 57233107
3-nonanoyloxydodecanoic acid
CID 171117444
3-icosanoyloxynonanoic acid
CID 171117466
3-tridecanoyloxyundecanoic acid
CID 171117589
3-pentadecanoyloxydodecanoic acid
CID 171117414
3-tetradecanoyloxydodecanoic acid
CID 171117412
(3R)-3-nonanoyloxytetradecanoic acid
CID 54008856
(3R)-3-acetyloxynonanoic acid
CID 54016264
3-[(Z)-pentadec-9-enoyl]oxyundecanoic acid
CID 171117594
3-[(Z)-docos-13-enoyl]oxydodecanoic acid
CID 171117432

Frequently Asked Questions

What is the IUPAC name of 3-(3-hydroxydec-2-enoyloxy)octanoic acid?
The IUPAC name of 3-(3-hydroxydec-2-enoyloxy)octanoic acid (CID 140865721) is 3-(3-hydroxydec-2-enoyloxy)octanoic acid.
What is the SMILES notation for 3-(3-hydroxydec-2-enoyloxy)octanoic acid?
The canonical SMILES for 3-(3-hydroxydec-2-enoyloxy)octanoic acid is CCCCCCCC(O)=CC(=O)OC(CCCCC)CC(=O)O.
What is the InChIKey of 3-(3-hydroxydec-2-enoyloxy)octanoic acid?
The InChIKey is JHUXTARWINDQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O5/c1-3-5-7-8-10-11-15(19)13-18(22)23-16(14-17(20)21)12-9-6-4-2/h13,16,19H,3-12,14H2,1-2H3,(H,20,21).
What are the key properties of 3-(3-hydroxydec-2-enoyloxy)octanoic acid?
3-(3-hydroxydec-2-enoyloxy)octanoic acid has a molecular weight of 328.45 g/mol, XLogP of 4.76, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxydec-2-enoyloxy)octanoic acid is sourced from PubChem (CID 140865721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).