C24H20BBr2NO2 — CID 140865961
5,10-dibromo-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene (PubChem CID 140865961) has the molecular formula C24H20BBr2NO2 and a molecular weight of 525.05 g/mol. Its IUPAC name is 5,10-dibromo-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene.
| Compound Name | 5,10-dibromo-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
|---|---|
| PubChem CID | 140865961 |
| Molecular Formula | C24H20BBr2NO2 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | 5,10-dibromo-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc(Br)cc4c5cc(Br)ccc5n3c42)OC1(C)C |
| InChI | InChI=1S/C24H20BBr2NO2/c1-23(2)24(3,4)30-25(29-23)13-5-7-20-16(9-13)18-11-15(27)12-19-17-10-14(26)6-8-21(17)28(20)22(18)19/h5-12H,1-4H3 |
| InChIKey | JVHZTEWGOGLZJA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 22.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|