C21H23ClF3N5OSi — CID 140866018
2-[[5-[7-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-7-methylindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140866018) has the molecular formula C21H23ClF3N5OSi and a molecular weight of 481.98 g/mol. Its IUPAC name is 2-[[5-[7-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-7-methylindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[7-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-7-methylindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140866018 |
| Molecular Formula | C21H23ClF3N5OSi |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-[[5-[7-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-7-methylindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(-c2c(Cl)ccn3nc(C(F)(F)F)nc23)cc2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C21H23ClF3N5OSi/c1-13-9-14(10-15-11-26-30(18(13)15)12-31-7-8-32(2,3)4)17-16(22)5-6-29-19(17)27-20(28-29)21(23,24)25/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | HPPXLRXHHGLCDJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|