C9H5ClF3N3 — CID 140866081
5-chloro-6-ethenyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 140866081) has the molecular formula C9H5ClF3N3 and a molecular weight of 247.61 g/mol. Its IUPAC name is 5-chloro-6-ethenyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-chloro-6-ethenyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 140866081 |
| Molecular Formula | C9H5ClF3N3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 5-chloro-6-ethenyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | C=Cc1ccc2nc(C(F)(F)F)nn2c1Cl |
| InChI | InChI=1S/C9H5ClF3N3/c1-2-5-3-4-6-14-8(9(11,12)13)15-16(6)7(5)10/h2-4H,1H2 |
| InChIKey | LACDNVWMMJYNQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|