C21H19F2N7O3 — CID 140866138
2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-hydroxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-oxazole-4-carboxamide (PubChem CID 140866138) has the molecular formula C21H19F2N7O3 and a molecular weight of 455.43 g/mol. Its IUPAC name is 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-hydroxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-hydroxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 140866138 |
| Molecular Formula | C21H19F2N7O3 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-hydroxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(-c2cnn(-c3cn(C4CCC(O)CC4)nc3-c3nc(F)ccc3F)c2)n1 |
| InChI | InChI=1S/C21H19F2N7O3/c22-14-5-6-17(23)27-18(14)19-16(9-29(28-19)12-1-3-13(31)4-2-12)30-8-11(7-25-30)21-26-15(10-33-21)20(24)32/h5-10,12-13,31H,1-4H2,(H2,24,32) |
| InChIKey | GXVKMGUGGKEETA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|