C14H15F6O6S2- — CID 140866340
[4-[2-[difluoro(oxido)-λ4-sulfanyl]-1,1,2,2-tetrafluoroethyl]sulfonyloxyphenyl] 2,2-dimethylbutanoate (PubChem CID 140866340) has the molecular formula C14H15F6O6S2- and a molecular weight of 457.39 g/mol. Its IUPAC name is [4-[2-[difluoro(oxido)-λ4-sulfanyl]-1,1,2,2-tetrafluoroethyl]sulfonyloxyphenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[2-[difluoro(oxido)-λ4-sulfanyl]-1,1,2,2-tetrafluoroethyl]sulfonyloxyphenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140866340 |
| Molecular Formula | C14H15F6O6S2- |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | [4-[2-[difluoro(oxido)-λ4-sulfanyl]-1,1,2,2-tetrafluoroethyl]sulfonyloxyphenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)S([O-])(F)F)cc1 |
| InChI | InChI=1S/C14H16F6O6S2/c1-4-12(2,3)11(21)25-9-5-7-10(8-6-9)26-28(23,24)14(17,18)13(15,16)27(19,20)22/h5-8,22H,4H2,1-3H3/p-1 |
| InChIKey | PHPVOJLFUKWSNU-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|