About [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate
[ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate (PubChem CID 14086645) has the molecular formula C10H20O7P2
and a molecular weight of 314.21 g/mol. Its IUPAC name is [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate |
| PubChem CID | 14086645 |
| Molecular Formula | C10H20O7P2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCC)OP(=O)(OCC)OCC=C |
| InChI | InChI=1S/C10H20O7P2/c1-5-9-15-18(11,13-7-3)17-19(12,14-8-4)16-10-6-2/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | UCGHLXUPLPLFOF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate?
The IUPAC name of [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate (CID 14086645) is [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate.
What is the SMILES notation for [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate?
The canonical SMILES for [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate is C=CCOP(=O)(OCC)OP(=O)(OCC)OCC=C.
What is the InChIKey of [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate?
The InChIKey is UCGHLXUPLPLFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O7P2/c1-5-9-15-18(11,13-7-3)17-19(12,14-8-4)16-10-6-2/h5-6H,1-2,7-10H2,3-4H3.
What are the key properties of [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate?
[ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate has a molecular weight of 314.21 g/mol, XLogP of 3.70, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(prop-2-enoxy)phosphoryl] ethyl prop-2-enyl phosphate is sourced from PubChem (CID 14086645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).