About [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate
[butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate (PubChem CID 14086647) has the molecular formula C14H28O7P2
and a molecular weight of 370.32 g/mol. Its IUPAC name is [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate |
| PubChem CID | 14086647 |
| Molecular Formula | C14H28O7P2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCCCC)OP(=O)(OCC=C)OCCCC |
| InChI | InChI=1S/C14H28O7P2/c1-5-9-13-19-22(15,17-11-7-3)21-23(16,18-12-8-4)20-14-10-6-2/h7-8H,3-6,9-14H2,1-2H3 |
| InChIKey | GLAOTGJHYLLFKW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate?
The IUPAC name of [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate (CID 14086647) is [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate.
What is the SMILES notation for [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate?
The canonical SMILES for [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate is C=CCOP(=O)(OCCCC)OP(=O)(OCC=C)OCCCC.
What is the InChIKey of [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate?
The InChIKey is GLAOTGJHYLLFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O7P2/c1-5-9-13-19-22(15,17-11-7-3)21-23(16,18-12-8-4)20-14-10-6-2/h7-8H,3-6,9-14H2,1-2H3.
What are the key properties of [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate?
[butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate has a molecular weight of 370.32 g/mol, XLogP of 5.26, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [butoxy(prop-2-enoxy)phosphoryl] butyl prop-2-enyl phosphate is sourced from PubChem (CID 14086647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).