About [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate
[2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate (PubChem CID 14086648) has the molecular formula C14H28O7P2
and a molecular weight of 370.32 g/mol. Its IUPAC name is [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate |
| PubChem CID | 14086648 |
| Molecular Formula | C14H28O7P2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCC(C)C)OP(=O)(OCC=C)OCC(C)C |
| InChI | InChI=1S/C14H28O7P2/c1-7-9-17-22(15,19-11-13(3)4)21-23(16,18-10-8-2)20-12-14(5)6/h7-8,13-14H,1-2,9-12H2,3-6H3 |
| InChIKey | MRFJJIPRRXWVDQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate?
The IUPAC name of [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate (CID 14086648) is [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate.
What is the SMILES notation for [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate?
The canonical SMILES for [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate is C=CCOP(=O)(OCC(C)C)OP(=O)(OCC=C)OCC(C)C.
What is the InChIKey of [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate?
The InChIKey is MRFJJIPRRXWVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O7P2/c1-7-9-17-22(15,19-11-13(3)4)21-23(16,18-10-8-2)20-12-14(5)6/h7-8,13-14H,1-2,9-12H2,3-6H3.
What are the key properties of [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate?
[2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate has a molecular weight of 370.32 g/mol, XLogP of 4.97, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methylpropoxy(prop-2-enoxy)phosphoryl] 2-methylpropyl prop-2-enyl phosphate is sourced from PubChem (CID 14086648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).