About 3-amino-2,4,5,6-tetrafluorobenzoate
3-amino-2,4,5,6-tetrafluorobenzoate (PubChem CID 140866576) has the molecular formula C7H2F4NO2-
and a molecular weight of 208.09 g/mol. Its IUPAC name is 3-amino-2,4,5,6-tetrafluorobenzoate.
Molecular Properties
| Compound Name | 3-amino-2,4,5,6-tetrafluorobenzoate |
| PubChem CID | 140866576 |
| Molecular Formula | C7H2F4NO2- |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 3-amino-2,4,5,6-tetrafluorobenzoate |
| SMILES | Nc1c(F)c(F)c(F)c(C(=O)[O-])c1F |
| InChI | InChI=1S/C7H3F4NO2/c8-2-1(7(13)14)3(9)6(12)5(11)4(2)10/h12H2,(H,13,14)/p-1 |
| InChIKey | CCNSCVGOSCRPAB-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,4,5,6-tetrafluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4,5,6-tetrafluorobenzoate?
The IUPAC name of 3-amino-2,4,5,6-tetrafluorobenzoate (CID 140866576) is 3-amino-2,4,5,6-tetrafluorobenzoate.
What is the SMILES notation for 3-amino-2,4,5,6-tetrafluorobenzoate?
The canonical SMILES for 3-amino-2,4,5,6-tetrafluorobenzoate is Nc1c(F)c(F)c(F)c(C(=O)[O-])c1F.
What is the InChIKey of 3-amino-2,4,5,6-tetrafluorobenzoate?
The InChIKey is CCNSCVGOSCRPAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H3F4NO2/c8-2-1(7(13)14)3(9)6(12)5(11)4(2)10/h12H2,(H,13,14)/p-1.
What are the key properties of 3-amino-2,4,5,6-tetrafluorobenzoate?
3-amino-2,4,5,6-tetrafluorobenzoate has a molecular weight of 208.09 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4,5,6-tetrafluorobenzoate is sourced from PubChem (CID 140866576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).