C20H28F3NO5Si — CID 140866782
1-O-benzyl 3-O-methyl (3R,6R)-6-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]piperidine-1,3-dicarboxylate (PubChem CID 140866782) has the molecular formula C20H28F3NO5Si and a molecular weight of 447.53 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3R,6R)-6-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (3R,6R)-6-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140866782 |
| Molecular Formula | C20H28F3NO5Si |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3R,6R)-6-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H]([C@H](O[Si](C)(C)C)C(F)(F)F)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H28F3NO5Si/c1-27-18(25)15-10-11-16(17(20(21,22)23)29-30(2,3)4)24(12-15)19(26)28-13-14-8-6-5-7-9-14/h5-9,15-17H,10-13H2,1-4H3/t15-,16-,17+/m1/s1 |
| InChIKey | NJMIYWRRZNIHAA-ZACQAIPSSA-N |
| XLogP | 4.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|