C25H33FN3O9P — CID 140866834
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-3-prop-2-enoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 140866834) has the molecular formula C25H33FN3O9P and a molecular weight of 569.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-3-prop-2-enoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-3-prop-2-enoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 140866834 |
| Molecular Formula | C25H33FN3O9P |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-3-prop-2-enoxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=CCO[C@@H]1[C@@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C25H33FN3O9P/c1-6-14-34-21-19(37-23(25(21,5)26)29-13-12-20(30)27-24(29)32)15-35-39(33,38-18-10-8-7-9-11-18)28-17(4)22(31)36-16(2)3/h6-13,16-17,19,21,23H,1,14-15H2,2-5H3,(H,28,33)(H,27,30,32)/t17-,19+,21+,23+,25+,39?/m0/s1 |
| InChIKey | WKMSLKTZYBGBFM-UQOBRVHBSA-N |
| XLogP | 2.87 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|