C25H44O4Si — CID 140867319
[(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 140867319) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 140867319 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(2R,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C=C(C)C[C@H](CC[C@@H]1O[C@@H](COC(=O)C(C)(C)C)CC1=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H44O4Si/c1-10-19(5)16-21(29-30(11-2,12-3)13-4)14-15-23-20(6)17-22(28-23)18-27-24(26)25(7,8)9/h21-23H,1,6,11-18H2,2-5,7-9H3/t21-,22+,23-/m0/s1 |
| InChIKey | VKGVAMVPTPPHAV-ZRBLBEILSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|