C29H61IO6Si3 — CID 140867321
(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-(3-hydroxypropyl)oxan-3-ol (PubChem CID 140867321) has the molecular formula C29H61IO6Si3 and a molecular weight of 716.96 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-(3-hydroxypropyl)oxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-(3-hydroxypropyl)oxan-3-ol |
|---|---|
| PubChem CID | 140867321 |
| Molecular Formula | C29H61IO6Si3 |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 716.28 |
| IUPAC Name | (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-(3-hydroxypropyl)oxan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)O[C@@H](CCCO)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H61IO6Si3/c1-27(2,3)37(10,11)34-22(18-19-30)24-26(36-39(14,15)29(7,8)9)25(35-38(12,13)28(4,5)6)23(32)21(33-24)17-16-20-31/h18-19,21-26,31-32H,16-17,20H2,1-15H3/b19-18+/t21-,22-,23-,24-,25-,26+/m0/s1 |
| InChIKey | PWSOVHRYMOXTHY-WYNDZQAKSA-N |
| XLogP | 8.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|