C29H59IO5Si3 — CID 140867325
(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-prop-2-enyloxan-3-ol (PubChem CID 140867325) has the molecular formula C29H59IO5Si3 and a molecular weight of 698.95 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-prop-2-enyloxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-prop-2-enyloxan-3-ol |
|---|---|
| PubChem CID | 140867325 |
| Molecular Formula | C29H59IO5Si3 |
| Molecular Weight | 698.95 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | (2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-2-prop-2-enyloxan-3-ol |
| SMILES | C=CC[C@@H]1O[C@@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C29H59IO5Si3/c1-17-18-21-23(31)25(34-37(13,14)28(5,6)7)26(35-38(15,16)29(8,9)10)24(32-21)22(19-20-30)33-36(11,12)27(2,3)4/h17,19-26,31H,1,18H2,2-16H3/b20-19+/t21-,22-,23-,24-,25-,26+/m0/s1 |
| InChIKey | KGPOBZXBAWUVAD-JEXFNBAASA-N |
| XLogP | 8.81 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.95 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|