C15H18BF2NO2 — CID 140867451
1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 140867451) has the molecular formula C15H18BF2NO2 and a molecular weight of 293.12 g/mol. Its IUPAC name is 1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 140867451 |
| Molecular Formula | C15H18BF2NO2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2ccc3ccn(C(F)F)c3c2)OC1(C)C |
| InChI | InChI=1S/C15H18BF2NO2/c1-14(2)15(3,4)21-16(20-14)11-6-5-10-7-8-19(13(17)18)12(10)9-11/h5-9,13H,1-4H3 |
| InChIKey | FEUDNFULRDHCLY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|