C9H12N2 — CID 14086796
(2Z,4Z,6Z)-7-(dimethylamino)hepta-2,4,6-trienenitrile (PubChem CID 14086796) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (2Z,4Z,6Z)-7-(dimethylamino)hepta-2,4,6-trienenitrile.
| Compound Name | (2Z,4Z,6Z)-7-(dimethylamino)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 14086796 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2Z,4Z,6Z)-7-(dimethylamino)hepta-2,4,6-trienenitrile |
| SMILES | CN(C)/C=C\C=C/C=C\C#N |
| InChI | InChI=1S/C9H12N2/c1-11(2)9-7-5-3-4-6-8-10/h3-7,9H,1-2H3/b5-3-,6-4-,9-7- |
| InChIKey | CNOJLRNPVIWVQU-DOPCVTHHSA-N |
| XLogP | 1.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|