C11H16N2 — CID 14086799
(2Z,4Z,6Z)-7-(diethylamino)hepta-2,4,6-trienenitrile (PubChem CID 14086799) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2Z,4Z,6Z)-7-(diethylamino)hepta-2,4,6-trienenitrile.
| Compound Name | (2Z,4Z,6Z)-7-(diethylamino)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 14086799 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (2Z,4Z,6Z)-7-(diethylamino)hepta-2,4,6-trienenitrile |
| SMILES | CCN(/C=C\C=C/C=C\C#N)CC |
| InChI | InChI=1S/C11H16N2/c1-3-13(4-2)11-9-7-5-6-8-10-12/h5-9,11H,3-4H2,1-2H3/b7-5-,8-6-,11-9- |
| InChIKey | NUSOAHACLHIHJE-LJTOGPOVSA-N |
| XLogP | 2.48 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|