C58H114O4 — CID 140868250
didecyl 3,12-didecyl-2,2,13,13-tetramethyltetradecanedioate (PubChem CID 140868250) has the molecular formula C58H114O4 and a molecular weight of 875.55 g/mol. Its IUPAC name is didecyl 3,12-didecyl-2,2,13,13-tetramethyltetradecanedioate.
| Compound Name | didecyl 3,12-didecyl-2,2,13,13-tetramethyltetradecanedioate |
|---|---|
| PubChem CID | 140868250 |
| Molecular Formula | C58H114O4 |
| Molecular Weight | 875.55 g/mol |
| Exact Mass | 874.87 |
| IUPAC Name | didecyl 3,12-didecyl-2,2,13,13-tetramethyltetradecanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(C)(C)C(CCCCCCCCCC)CCCCCCCCC(CCCCCCCCCC)C(C)(C)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C58H114O4/c1-9-13-17-21-25-29-35-41-47-53(57(5,6)55(59)61-51-45-39-33-27-23-19-15-11-3)49-43-37-31-32-38-44-50-54(48-42-36-30-26-22-18-14-10-2)58(7,8)56(60)62-52-46-40-34-28-24-20-16-12-4/h53-54H,9-52H2,1-8H3 |
| InChIKey | CRFDDHXIBRZJBK-UHFFFAOYSA-N |
| XLogP | 19.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.55 |
| LogP ≤ 5 | 19.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|