C24H25N5O — CID 140868806
(5aS,6S,9aS)-8-isocyano-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-2-phenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one (PubChem CID 140868806) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is (5aS,6S,9aS)-8-isocyano-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-2-phenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one.
| Compound Name | (5aS,6S,9aS)-8-isocyano-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-2-phenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one |
|---|---|
| PubChem CID | 140868806 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (5aS,6S,9aS)-8-isocyano-6,9a-dimethyl-3-(1-methylpyrazol-4-yl)-2-phenyl-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazol-7-one |
| SMILES | [C-]#[N+]C1C[C@]2(C)c3nc(-c4ccccc4)n(-c4cnn(C)c4)c3CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C24H25N5O/c1-15-18-10-11-20-22(24(18,2)12-19(25-3)21(15)30)27-23(16-8-6-5-7-9-16)29(20)17-13-26-28(4)14-17/h5-9,13-15,18-19H,10-12H2,1-2,4H3/t15-,18-,19?,24-/m0/s1 |
| InChIKey | XYGSLGHNILPUGO-JINKPBGESA-N |
| XLogP | 3.99 |
| TPSA | 57.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|