C21H36O4Si — CID 140868860
(1S,2S,5S,7S,8R,9R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-cyclopropyl-1,5-dimethyl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol (PubChem CID 140868860) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (1S,2S,5S,7S,8R,9R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-cyclopropyl-1,5-dimethyl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol.
| Compound Name | (1S,2S,5S,7S,8R,9R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-cyclopropyl-1,5-dimethyl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
|---|---|
| PubChem CID | 140868860 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (1S,2S,5S,7S,8R,9R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-cyclopropyl-1,5-dimethyl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@]2(C3CC3)O[C@@]1(C)[C@@H]1CC[C@]3(C)O[C@]13[C@@H]2O |
| InChI | InChI=1S/C21H36O4Si/c1-17(2,3)26(6,7)23-15-12-20(13-8-9-13)16(22)21-14(19(15,5)25-20)10-11-18(21,4)24-21/h13-16,22H,8-12H2,1-7H3/t14-,15+,16+,18-,19-,20+,21-/m0/s1 |
| InChIKey | VYOCKXOXDDUGSQ-GYYLUEGMSA-N |
| XLogP | 4.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|