C24H42O3Si — CID 140868877
(1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol (PubChem CID 140868877) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol.
| Compound Name | (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
|---|---|
| PubChem CID | 140868877 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@]2(C3CCCCC3)C=C3[C@@H](CC[C@]3(C)O)[C@]1(C)O2 |
| InChI | InChI=1S/C24H42O3Si/c1-21(2,3)28(6,7)26-20-16-24(17-11-9-8-10-12-17)15-19-18(23(20,5)27-24)13-14-22(19,4)25/h15,17-18,20,25H,8-14,16H2,1-7H3/t18-,20-,22+,23+,24+/m1/s1 |
| InChIKey | DZZGPEZLMOEJMM-MSHBDYGVSA-N |
| XLogP | 5.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|