C21H36O3Si — CID 140868886
(1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclopropyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol (PubChem CID 140868886) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclopropyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol.
| Compound Name | (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclopropyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
|---|---|
| PubChem CID | 140868886 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S,2R,5S,8S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclopropyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@]2(C3CC3)C=C3[C@@H](CC[C@]3(C)O)[C@]1(C)O2 |
| InChI | InChI=1S/C21H36O3Si/c1-18(2,3)25(6,7)23-17-13-21(14-8-9-14)12-16-15(20(17,5)24-21)10-11-19(16,4)22/h12,14-15,17,22H,8-11,13H2,1-7H3/t15-,17-,19+,20+,21+/m1/s1 |
| InChIKey | SAOHFJZRVAACKJ-ZIKUCTJESA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|