C12H24O — CID 14086942
(2R,3R)-2,3-dipentyloxirane (PubChem CID 14086942) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (2R,3R)-2,3-dipentyloxirane.
| Compound Name | (2R,3R)-2,3-dipentyloxirane |
|---|---|
| PubChem CID | 14086942 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (2R,3R)-2,3-dipentyloxirane |
| SMILES | CCCCC[C@H]1O[C@@H]1CCCCC |
| InChI | InChI=1S/C12H24O/c1-3-5-7-9-11-12(13-11)10-8-6-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | YLERZYQHAUPNIA-VXGBXAGGSA-N |
| XLogP | 3.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|