About 5,6-diethoxy-3-phenyl-1,2-benzothiazole
5,6-diethoxy-3-phenyl-1,2-benzothiazole (PubChem CID 14086969) has the molecular formula C17H17NO2S
and a molecular weight of 299.40 g/mol. Its IUPAC name is 5,6-diethoxy-3-phenyl-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5,6-diethoxy-3-phenyl-1,2-benzothiazole |
| PubChem CID | 14086969 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 5,6-diethoxy-3-phenyl-1,2-benzothiazole |
| SMILES | CCOc1cc2snc(-c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C17H17NO2S/c1-3-19-14-10-13-16(11-15(14)20-4-2)21-18-17(13)12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3 |
| InChIKey | QBUIDJXNEPVJDY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-diethoxy-3-phenyl-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethoxy-3-phenyl-1,2-benzothiazole?
The IUPAC name of 5,6-diethoxy-3-phenyl-1,2-benzothiazole (CID 14086969) is 5,6-diethoxy-3-phenyl-1,2-benzothiazole.
What is the SMILES notation for 5,6-diethoxy-3-phenyl-1,2-benzothiazole?
The canonical SMILES for 5,6-diethoxy-3-phenyl-1,2-benzothiazole is CCOc1cc2snc(-c3ccccc3)c2cc1OCC.
What is the InChIKey of 5,6-diethoxy-3-phenyl-1,2-benzothiazole?
The InChIKey is QBUIDJXNEPVJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2S/c1-3-19-14-10-13-16(11-15(14)20-4-2)21-18-17(13)12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3.
What are the key properties of 5,6-diethoxy-3-phenyl-1,2-benzothiazole?
5,6-diethoxy-3-phenyl-1,2-benzothiazole has a molecular weight of 299.40 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethoxy-3-phenyl-1,2-benzothiazole is sourced from PubChem (CID 14086969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).