C16H30N2OS2 — CID 140870575
2,5-bis(4-methylsulfanylcyclohexyl)-1,3,4-oxadiazolidine (PubChem CID 140870575) has the molecular formula C16H30N2OS2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,5-bis(4-methylsulfanylcyclohexyl)-1,3,4-oxadiazolidine.
| Compound Name | 2,5-bis(4-methylsulfanylcyclohexyl)-1,3,4-oxadiazolidine |
|---|---|
| PubChem CID | 140870575 |
| Molecular Formula | C16H30N2OS2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2,5-bis(4-methylsulfanylcyclohexyl)-1,3,4-oxadiazolidine |
| SMILES | CSC1CCC(C2NNC(C3CCC(SC)CC3)O2)CC1 |
| InChI | InChI=1S/C16H30N2OS2/c1-20-13-7-3-11(4-8-13)15-17-18-16(19-15)12-5-9-14(21-2)10-6-12/h11-18H,3-10H2,1-2H3 |
| InChIKey | YDLQWTDJTWFDBN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |